C19H19BClN5O8PS+ — CID 136501344
CID 136501344 (PubChem CID 136501344) has the molecular formula C19H19BClN5O8PS+ and a molecular weight of 554.69 g/mol.
| Compound Name | CID 136501344 |
|---|---|
| PubChem CID | 136501344 |
| Molecular Formula | C19H19BClN5O8PS+ |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | — |
| SMILES | [B][P+]1(OCOC(C)=O)OC[C@H]2O[C@@H](n3c(Sc4ccc(Cl)cc4)nc4c(=O)[nH]c(N)nc43)C(O)[C@H]2O1 |
| InChI | InChI=1S/C19H19BClN5O8PS/c1-8(27)30-7-32-35(20)31-6-11-14(34-35)13(28)17(33-11)26-15-12(16(29)25-18(22)24-15)23-19(26)36-10-4-2-9(21)3-5-10/h2-5,11,13-14,17,28H,6-7H2,1H3,(H3,22,24,25,29)/q+1/t11-,13?,14+,17-,35?/m1/s1 |
| InChIKey | RIWKKXOTFWFGHW-QZLGSANXSA-N |
| XLogP | 1.56 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|