C21H24BN5O7PS+ — CID 90086077
CID 90086077 (PubChem CID 90086077) has the molecular formula C21H24BN5O7PS+ and a molecular weight of 532.30 g/mol.
| Compound Name | CID 90086077 |
|---|---|
| PubChem CID | 90086077 |
| Molecular Formula | C21H24BN5O7PS+ |
| Molecular Weight | 532.30 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | — |
| SMILES | [B][P+]1(OCOC(C)=O)OC[C@H]2O[C@@H](n3c(SCc4ccccc4)nc4c(N)ncnc43)C(OC)[C@@H]2O1 |
| InChI | InChI=1S/C21H24BN5O7PS/c1-12(28)30-11-32-35(22)31-8-14-16(34-35)17(29-2)20(33-14)27-19-15(18(23)24-10-25-19)26-21(27)36-9-13-6-4-3-5-7-13/h3-7,10,14,16-17,20H,8-9,11H2,1-2H3,(H2,23,24,25)/q+1/t14-,16-,17?,20-,35?/m1/s1 |
| InChIKey | HGEGKQBWENMRNY-NNFUPQOWSA-N |
| XLogP | 2.41 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|