C17H27N5O6PS+ — CID 58637982
9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-hexylsulfanylpurin-6-amine (PubChem CID 58637982) has the molecular formula C17H27N5O6PS+ and a molecular weight of 460.47 g/mol. Its IUPAC name is 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-hexylsulfanylpurin-6-amine.
| Compound Name | 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-hexylsulfanylpurin-6-amine |
|---|---|
| PubChem CID | 58637982 |
| Molecular Formula | C17H27N5O6PS+ |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-hexylsulfanylpurin-6-amine |
| SMILES | CCCCCCSc1nc2c(N)ncnc2n1[C@@H]1O[C@H]2CO[P+](O)(O)O[C@@H]2C1OC |
| InChI | InChI=1S/C17H27N5O6PS/c1-3-4-5-6-7-30-17-21-11-14(18)19-9-20-15(11)22(17)16-13(25-2)12-10(27-16)8-26-29(23,24)28-12/h9-10,12-13,16,23-24H,3-8H2,1-2H3,(H2,18,19,20)/q+1/t10-,12-,13?,16+/m0/s1 |
| InChIKey | BFXGQHOSIFZMRR-GWVPEMGJSA-N |
| XLogP | 2.07 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|