C18H21N5O7P+ — CID 58637988
9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-phenylmethoxypurin-6-amine (PubChem CID 58637988) has the molecular formula C18H21N5O7P+ and a molecular weight of 450.37 g/mol. Its IUPAC name is 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-phenylmethoxypurin-6-amine.
| Compound Name | 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-phenylmethoxypurin-6-amine |
|---|---|
| PubChem CID | 58637988 |
| Molecular Formula | C18H21N5O7P+ |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 9-[(4aS,6R,7aS)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-phenylmethoxypurin-6-amine |
| SMILES | COC1[C@H]2O[P+](O)(O)OC[C@@H]2O[C@H]1n1c(OCc2ccccc2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21N5O7P/c1-26-14-13-11(8-28-31(24,25)30-13)29-17(14)23-16-12(15(19)20-9-21-16)22-18(23)27-7-10-5-3-2-4-6-10/h2-6,9,11,13-14,17,24-25H,7-8H2,1H3,(H2,19,20,21)/q+1/t11-,13-,14?,17+/m0/s1 |
| InChIKey | MKUWOCZCVFQSPH-TUJXTFBESA-N |
| XLogP | 0.98 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|