C24H24N5O6PSe — CID 12961878
(4aR,6R,7R,7aS)-6-(6-amino-8-benzylselanylpurin-9-yl)-2-oxo-2-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 12961878) has the molecular formula C24H24N5O6PSe and a molecular weight of 588.42 g/mol. Its IUPAC name is (4aR,6R,7R,7aS)-6-(6-amino-8-benzylselanylpurin-9-yl)-2-oxo-2-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (4aR,6R,7R,7aS)-6-(6-amino-8-benzylselanylpurin-9-yl)-2-oxo-2-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 12961878 |
| Molecular Formula | C24H24N5O6PSe |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | (4aR,6R,7R,7aS)-6-(6-amino-8-benzylselanylpurin-9-yl)-2-oxo-2-phenylmethoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | Nc1ncnc2c1nc([Se]Cc1ccccc1)n2[C@@H]1O[C@@H]2COP(=O)(OCc3ccccc3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C24H24N5O6PSe/c25-21-18-22(27-14-26-21)29(24(28-18)37-13-16-9-5-2-6-10-16)23-19(30)20-17(34-23)12-33-36(31,35-20)32-11-15-7-3-1-4-8-15/h1-10,14,17,19-20,23,30H,11-13H2,(H2,25,26,27)/t17-,19-,20-,23-,36?/m1/s1 |
| InChIKey | GSRFOKQAWOUDIY-UGUPJJOHSA-N |
| XLogP | 1.94 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|