C17H17N6O8P — CID 90678747
(2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-[(4-nitrophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 90678747) has the molecular formula C17H17N6O8P and a molecular weight of 464.33 g/mol. Its IUPAC name is (2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-[(4-nitrophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-[(4-nitrophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 90678747 |
| Molecular Formula | C17H17N6O8P |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | (2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-[(4-nitrophenyl)methoxy]-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CO[P@@](=O)(OCc3ccc([N+](=O)[O-])cc3)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C17H17N6O8P/c18-15-12-16(20-7-19-15)22(8-21-12)17-13(24)14-11(30-17)6-29-32(27,31-14)28-5-9-1-3-10(4-2-9)23(25)26/h1-4,7-8,11,13-14,17,24H,5-6H2,(H2,18,19,20)/t11-,13-,14-,17-,32-/m1/s1 |
| InChIKey | WBLNHPUJDGAYLB-XVLJZMFLSA-N |
| XLogP | 1.32 |
| TPSA | 186.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|