C14H18N5O7P — CID 3036950
[(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] butanoate (PubChem CID 3036950) has the molecular formula C14H18N5O7P and a molecular weight of 399.30 g/mol. Its IUPAC name is [(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] butanoate.
| Compound Name | [(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] butanoate |
|---|---|
| PubChem CID | 3036950 |
| Molecular Formula | C14H18N5O7P |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [(4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl] butanoate |
| SMILES | CCCC(=O)OP1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C14H18N5O7P/c1-2-3-8(20)25-27(22)23-4-7-11(26-27)10(21)14(24-7)19-6-18-9-12(15)16-5-17-13(9)19/h5-7,10-11,14,21H,2-4H2,1H3,(H2,15,16,17)/t7-,10-,11-,14-,27?/m1/s1 |
| InChIKey | ZLDCZSIYOHFKLS-XDNOHMGLSA-N |
| XLogP | 0.53 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|