C21H25FN10O11P2 — CID 122451791
(1S,6R,8R,9S,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 122451791) has the molecular formula C21H25FN10O11P2 and a molecular weight of 674.44 g/mol. Its IUPAC name is (1S,6R,8R,9S,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | (1S,6R,8R,9S,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 122451791 |
| Molecular Formula | C21H25FN10O11P2 |
| Molecular Weight | 674.44 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | (1S,6R,8R,9S,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | COP1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](F)C2OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](O1)C2O |
| InChI | InChI=1S/C21H25FN10O11P2/c1-37-45(36)39-3-9-14(10(22)20(41-9)31-6-29-11-16(23)25-4-27-18(11)31)42-44(34,35)38-2-8-13(33)15(43-45)21(40-8)32-7-30-12-17(24)26-5-28-19(12)32/h4-10,13-15,20-21,33H,2-3H2,1H3,(H,34,35)(H2,23,25,27)(H2,24,26,28)/t8-,9-,10+,13?,14?,15+,20-,21-,45?/m1/s1 |
| InChIKey | KHVMFTWEHUYJEK-SYAWPQDISA-N |
| XLogP | -0.00 |
| TPSA | 278.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.44 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|