C20H23FN11O10PS — CID 155476761
8,17-bis(6-aminopurin-9-yl)-9-fluoro-3-hydroxy-3,12,12-trioxo-2,4,7,11,16-pentaoxa-12λ6-thia-13-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 155476761) has the molecular formula C20H23FN11O10PS and a molecular weight of 659.51 g/mol. Its IUPAC name is 8,17-bis(6-aminopurin-9-yl)-9-fluoro-3-hydroxy-3,12,12-trioxo-2,4,7,11,16-pentaoxa-12λ6-thia-13-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | 8,17-bis(6-aminopurin-9-yl)-9-fluoro-3-hydroxy-3,12,12-trioxo-2,4,7,11,16-pentaoxa-12λ6-thia-13-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 155476761 |
| Molecular Formula | C20H23FN11O10PS |
| Molecular Weight | 659.51 g/mol |
| Exact Mass | 659.11 |
| IUPAC Name | 8,17-bis(6-aminopurin-9-yl)-9-fluoro-3-hydroxy-3,12,12-trioxo-2,4,7,11,16-pentaoxa-12λ6-thia-13-aza-3λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC3C(O)C(CNS(=O)(=O)OC2C1F)OC3n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H23FN11O10PS/c21-9-13-8(40-19(9)31-5-28-10-15(22)24-3-26-17(10)31)2-38-43(34,35)41-14-12(33)7(1-30-44(36,37)42-13)39-20(14)32-6-29-11-16(23)25-4-27-18(11)32/h3-9,12-14,19-20,30,33H,1-2H2,(H,34,35)(H2,22,24,26)(H2,23,25,27) |
| InChIKey | IUVQRJKHVGLGPI-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 289.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.51 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|