C21H25FN10O10P2 — CID 129203179
(6R,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 129203179) has the molecular formula C21H25FN10O10P2 and a molecular weight of 658.44 g/mol. Its IUPAC name is (6R,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | (6R,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 129203179 |
| Molecular Formula | C21H25FN10O10P2 |
| Molecular Weight | 658.44 g/mol |
| Exact Mass | 658.12 |
| IUPAC Name | (6R,15R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | CP1(=O)OC[C@H]2OC(n3cnc4c(N)ncnc43)C(F)C2OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(O1)C2O |
| InChI | InChI=1S/C21H25FN10O10P2/c1-43(34)37-3-9-14(10(22)20(40-9)31-6-29-11-16(23)25-4-27-18(11)31)42-44(35,36)38-2-8-13(33)15(41-43)21(39-8)32-7-30-12-17(24)26-5-28-19(12)32/h4-10,13-15,20-21,33H,2-3H2,1H3,(H,35,36)(H2,23,25,27)(H2,24,26,28)/t8-,9-,10?,13?,14?,15?,20?,21-,43?/m1/s1 |
| InChIKey | QQCKAFKNPBMEBY-XIUPWGSXSA-N |
| XLogP | 0.06 |
| TPSA | 269.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|