C20H23FN10O9P2S — CID 129202950
(3R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-12-oxo-3-sulfanyl-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 129202950) has the molecular formula C20H23FN10O9P2S and a molecular weight of 660.48 g/mol. Its IUPAC name is (3R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-12-oxo-3-sulfanyl-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | (3R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-12-oxo-3-sulfanyl-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 129202950 |
| Molecular Formula | C20H23FN10O9P2S |
| Molecular Weight | 660.48 g/mol |
| Exact Mass | 660.08 |
| IUPAC Name | (3R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-12-oxo-3-sulfanyl-2,4,7,11,13,16-hexaoxa-3,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2CO[P@@](S)OC3C(O)C(COP(=O)(O)OC2C1F)OC3n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H23FN10O9P2S/c21-9-13-8(38-19(9)30-5-28-10-15(22)24-3-26-17(10)30)1-35-41(43)39-14-12(32)7(2-36-42(33,34)40-13)37-20(14)31-6-29-11-16(23)25-4-27-18(11)31/h3-9,12-14,19-20,32,43H,1-2H2,(H,33,34)(H2,22,24,26)(H2,23,25,27)/t7?,8?,9?,12?,13?,14?,19?,20?,41-/m1/s1 |
| InChIKey | FJSOVOVYFOVBJJ-USRXPGSLSA-N |
| XLogP | 0.40 |
| TPSA | 252.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|