C20H21FN9O11PS — CID 155476613
8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-17-purin-9-yl-2,4,7,11,13,16-hexaoxa-3λ6-thia-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 155476613) has the molecular formula C20H21FN9O11PS and a molecular weight of 645.48 g/mol. Its IUPAC name is 8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-17-purin-9-yl-2,4,7,11,13,16-hexaoxa-3λ6-thia-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | 8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-17-purin-9-yl-2,4,7,11,13,16-hexaoxa-3λ6-thia-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 155476613 |
| Molecular Formula | C20H21FN9O11PS |
| Molecular Weight | 645.48 g/mol |
| Exact Mass | 645.08 |
| IUPAC Name | 8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-17-purin-9-yl-2,4,7,11,13,16-hexaoxa-3λ6-thia-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COS(=O)(=O)OC3C(O)C(COP(=O)(O)OC2C1F)OC3n1cnc2cncnc21 |
| InChI | InChI=1S/C20H21FN9O11PS/c21-11-14-10(39-19(11)30-7-28-12-16(22)24-5-26-18(12)30)3-37-43(34,35)41-15-13(31)9(2-36-42(32,33)40-14)38-20(15)29-6-27-8-1-23-4-25-17(8)29/h1,4-7,9-11,13-15,19-20,31H,2-3H2,(H,32,33)(H2,22,24,26) |
| InChIKey | VBPXHFKBLHDDDT-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 260.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.48 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|