C21H26N10O11P2 — CID 155062808
(1S,8R,9R,10S,17R)-8,17-bis(6-aminopurin-9-yl)-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol (PubChem CID 155062808) has the molecular formula C21H26N10O11P2 and a molecular weight of 656.45 g/mol. Its IUPAC name is (1S,8R,9R,10S,17R)-8,17-bis(6-aminopurin-9-yl)-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol.
| Compound Name | (1S,8R,9R,10S,17R)-8,17-bis(6-aminopurin-9-yl)-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol |
|---|---|
| PubChem CID | 155062808 |
| Molecular Formula | C21H26N10O11P2 |
| Molecular Weight | 656.45 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | (1S,8R,9R,10S,17R)-8,17-bis(6-aminopurin-9-yl)-12-hydroxy-3-methoxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol |
| SMILES | COP1(=O)OCC2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2OP(=O)(O)OCC2O[C@@H](n3cnc4c(N)ncnc43)C[C@@H]2O1 |
| InChI | InChI=1S/C21H26N10O11P2/c1-36-44(35)38-4-11-16(15(32)21(40-11)31-8-29-14-18(23)25-6-27-20(14)31)42-43(33,34)37-3-10-9(41-44)2-12(39-10)30-7-28-13-17(22)24-5-26-19(13)30/h5-12,15-16,21,32H,2-4H2,1H3,(H,33,34)(H2,22,24,26)(H2,23,25,27)/t9-,10?,11?,12+,15+,16+,21+,44?/m0/s1 |
| InChIKey | KIOWBMVBTSLFCQ-FVJCNLRUSA-N |
| XLogP | 0.05 |
| TPSA | 278.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|