C22H25N7O12P2 — CID 146352154
8-(6-aminopurin-9-yl)-17-(benzimidazol-1-yl)-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecane-9,18-diol (PubChem CID 146352154) has the molecular formula C22H25N7O12P2 and a molecular weight of 641.43 g/mol. Its IUPAC name is 8-(6-aminopurin-9-yl)-17-(benzimidazol-1-yl)-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecane-9,18-diol.
| Compound Name | 8-(6-aminopurin-9-yl)-17-(benzimidazol-1-yl)-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecane-9,18-diol |
|---|---|
| PubChem CID | 146352154 |
| Molecular Formula | C22H25N7O12P2 |
| Molecular Weight | 641.43 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | 8-(6-aminopurin-9-yl)-17-(benzimidazol-1-yl)-3,12-dihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecane-9,18-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC3C(COP(=O)(O)OC2C1O)OC(n1cnc2ccccc21)C3O |
| InChI | InChI=1S/C22H25N7O12P2/c23-19-14-20(25-7-24-19)29(9-27-14)22-16(31)18-13(39-22)6-37-42(32,33)40-17-12(5-36-43(34,35)41-18)38-21(15(17)30)28-8-26-10-3-1-2-4-11(10)28/h1-4,7-9,12-13,15-18,21-22,30-31H,5-6H2,(H,32,33)(H,34,35)(H2,23,24,25) |
| InChIKey | XCKWYBKXVLURHV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 257.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|