C22H24N6O13P2 — CID 147807273
9-[(6R,8R,15R,17R)-8-(benzimidazol-1-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 147807273) has the molecular formula C22H24N6O13P2 and a molecular weight of 642.41 g/mol. Its IUPAC name is 9-[(6R,8R,15R,17R)-8-(benzimidazol-1-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 9-[(6R,8R,15R,17R)-8-(benzimidazol-1-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 147807273 |
| Molecular Formula | C22H24N6O13P2 |
| Molecular Weight | 642.41 g/mol |
| Exact Mass | 642.09 |
| IUPAC Name | 9-[(6R,8R,15R,17R)-8-(benzimidazol-1-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)OC3C(O)[C@H](n4cnc5ccccc54)O[C@@H]3COP(=O)(O)OC1C2O |
| InChI | InChI=1S/C22H24N6O13P2/c29-15-12-5-36-42(32,33)40-17-13(39-21(16(17)30)27-8-25-10-3-1-2-4-11(10)27)6-37-43(34,35)41-18(15)22(38-12)28-9-26-14-19(28)23-7-24-20(14)31/h1-4,7-9,12-13,15-18,21-22,29-30H,5-6H2,(H,32,33)(H,34,35)(H,23,24,31)/t12-,13-,15?,16?,17?,18?,21-,22-/m1/s1 |
| InChIKey | HMRDUFRHUROLIN-XGLFZUKKSA-N |
| XLogP | -0.30 |
| TPSA | 251.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|