C24H26N4O12P2 — CID 146352168
8,16-bis(benzimidazol-1-yl)-3,11-dihydroxy-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol (PubChem CID 146352168) has the molecular formula C24H26N4O12P2 and a molecular weight of 624.44 g/mol. Its IUPAC name is 8,16-bis(benzimidazol-1-yl)-3,11-dihydroxy-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol.
| Compound Name | 8,16-bis(benzimidazol-1-yl)-3,11-dihydroxy-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol |
|---|---|
| PubChem CID | 146352168 |
| Molecular Formula | C24H26N4O12P2 |
| Molecular Weight | 624.44 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | 8,16-bis(benzimidazol-1-yl)-3,11-dihydroxy-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol |
| SMILES | O=P1(O)OCC2OC(n3cnc4ccccc43)C(OP(=O)(O)OCC3OC(n4cnc5ccccc54)C(O1)C3O)C2O |
| InChI | InChI=1S/C24H26N4O12P2/c29-19-17-9-35-42(33,34)40-22-20(30)18(38-24(22)28-12-26-14-6-2-4-8-16(14)28)10-36-41(31,32)39-21(19)23(37-17)27-11-25-13-5-1-3-7-15(13)27/h1-8,11-12,17-24,29-30H,9-10H2,(H,31,32)(H,33,34) |
| InChIKey | KDUQSDSULFREMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 206.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|