C21H24FN10O10P2S- — CID 149392605
(6R,8R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-3-oxido-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol (PubChem CID 149392605) has the molecular formula C21H24FN10O10P2S- and a molecular weight of 689.50 g/mol. Its IUPAC name is (6R,8R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-3-oxido-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol.
| Compound Name | (6R,8R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-3-oxido-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
|---|---|
| PubChem CID | 149392605 |
| Molecular Formula | C21H24FN10O10P2S- |
| Molecular Weight | 689.50 g/mol |
| Exact Mass | 689.09 |
| IUPAC Name | (6R,8R,17R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-3-oxido-12-oxo-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-18-ol |
| SMILES | COP1(=O)OCC2O[C@@H](n3cnc4c(N)ncnc43)C(OP([O-])(=S)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)C(F)C3O1)C2O |
| InChI | InChI=1S/C21H25FN10O10P2S/c1-36-43(34)37-2-8-13(33)15(21(39-8)32-7-30-12-17(24)26-5-28-19(12)32)42-44(35,45)38-3-9-14(41-43)10(22)20(40-9)31-6-29-11-16(23)25-4-27-18(11)31/h4-10,13-15,20-21,33H,2-3H2,1H3,(H,35,45)(H2,23,25,27)(H2,24,26,28)/p-1/t8?,9-,10?,13?,14?,15?,20-,21-,43?,44?/m1/s1 |
| InChIKey | YNVGAYNYKMSUOE-DBBKBUFQSA-M |
| XLogP | -0.52 |
| TPSA | 264.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.50 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|