C23H27FN10O9P2S — CID 129203009
(3S,6R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-18-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-3-carbothialdehyde (PubChem CID 129203009) has the molecular formula C23H27FN10O9P2S and a molecular weight of 700.54 g/mol. Its IUPAC name is (3S,6R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-18-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-3-carbothialdehyde.
| Compound Name | (3S,6R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-18-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-3-carbothialdehyde |
|---|---|
| PubChem CID | 129203009 |
| Molecular Formula | C23H27FN10O9P2S |
| Molecular Weight | 700.54 g/mol |
| Exact Mass | 700.11 |
| IUPAC Name | (3S,6R)-8,17-bis(6-aminopurin-9-yl)-9-fluoro-12-methoxy-18-methyl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecane-3-carbothialdehyde |
| SMILES | COP1(=O)OCC2OC(n3cnc4c(N)ncnc43)C(O[P@](=O)(C=S)OC[C@H]3OC(n4cnc5c(N)ncnc54)C(F)C3O1)C2C |
| InChI | InChI=1S/C23H27FN10O9P2S/c1-10-11-3-39-45(36,37-2)43-17-12(41-22(13(17)24)33-7-31-14-18(25)27-5-29-20(14)33)4-38-44(35,9-46)42-16(10)23(40-11)34-8-32-15-19(26)28-6-30-21(15)34/h5-13,16-17,22-23H,3-4H2,1-2H3,(H2,25,27,29)(H2,26,28,30)/t10?,11?,12-,13?,16?,17?,22?,23?,44+,45?/m1/s1 |
| InChIKey | PNEDJVNINIXURR-RZWHKRGXSA-N |
| XLogP | 2.32 |
| TPSA | 237.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|