C20H20BF2N10O8P2S- — CID 162474860
CID 162474860 (PubChem CID 162474860) has the molecular formula C20H20BF2N10O8P2S- and a molecular weight of 671.26 g/mol.
| Compound Name | CID 162474860 |
|---|---|
| PubChem CID | 162474860 |
| Molecular Formula | C20H20BF2N10O8P2S- |
| Molecular Weight | 671.26 g/mol |
| Exact Mass | 671.07 |
| IUPAC Name | — |
| SMILES | [B][P@@]1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](F)C2OP([O-])(=S)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H](F)C2O1 |
| InChI | InChI=1S/C20H21BF2N10O8P2S/c21-42(34)36-1-7-14(10(23)20(38-7)33-6-31-12-16(25)27-4-29-18(12)33)41-43(35,44)37-2-8-13(40-42)9(22)19(39-8)32-5-30-11-15(24)26-3-28-17(11)32/h3-10,13-14,19-20H,1-2H2,(H,35,44)(H2,24,26,28)(H2,25,27,29)/p-1/t7-,8-,9+,10+,13?,14?,19-,20-,42-,43?/m1/s1 |
| InChIKey | ZXEIVCHWYDFLCK-CFDAYAOPSA-M |
| XLogP | -0.02 |
| TPSA | 234.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|