C21H20B2F2N8O9P2 — CID 163780145
CID 163780145 (PubChem CID 163780145) has the molecular formula C21H20B2F2N8O9P2 and a molecular weight of 650.01 g/mol.
| Compound Name | CID 163780145 |
|---|---|
| PubChem CID | 163780145 |
| Molecular Formula | C21H20B2F2N8O9P2 |
| Molecular Weight | 650.01 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2OP([B])(=O)OC[C@H]2O[C@@H](n3cnc4c3C=NCC4=O)[C@@H](F)C2O1 |
| InChI | InChI=1S/C21H20B2F2N8O9P2/c22-43(35)38-4-11-17(13(25)21(40-11)33-7-31-15-18(26)28-5-29-19(15)33)42-44(23,36)37-3-10-16(41-43)12(24)20(39-10)32-6-30-14-8(32)1-27-2-9(14)34/h1,5-7,10-13,16-17,20-21H,2-4H2,(H2,26,28,29)/t10-,11-,12+,13?,16?,17+,20-,21-,43?,44?/m1/s1 |
| InChIKey | IYEZVLGVQZUCCY-BNVQGNSWSA-N |
| XLogP | 0.76 |
| TPSA | 206.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.01 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|