C21H21BF2N8O9P2S — CID 163485817
CID 163485817 (PubChem CID 163485817) has the molecular formula C21H21BF2N8O9P2S and a molecular weight of 672.27 g/mol.
| Compound Name | CID 163485817 |
|---|---|
| PubChem CID | 163485817 |
| Molecular Formula | C21H21BF2N8O9P2S |
| Molecular Weight | 672.27 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cnc4c3C=NCC4=O)[C@@H](F)C2OP(O)(=S)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2O1 |
| InChI | InChI=1S/C21H21BF2N8O9P2S/c22-42(34)36-3-10-17(13(24)20(38-10)31-6-29-14-8(31)1-26-2-9(14)33)41-43(35,44)37-4-11-16(40-42)12(23)21(39-11)32-7-30-15-18(25)27-5-28-19(15)32/h1,5-7,10-13,16-17,20-21H,2-4H2,(H,35,44)(H2,25,27,28)/t10-,11-,12?,13+,16+,17?,20-,21-,42?,43?/m1/s1 |
| InChIKey | ABCLUWVNXJPXGE-KUCAHEASSA-N |
| XLogP | 0.70 |
| TPSA | 209.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|