C21H22BF2N9O8P2S — CID 174118093
CID 174118093 (PubChem CID 174118093) has the molecular formula C21H22BF2N9O8P2S and a molecular weight of 671.28 g/mol.
| Compound Name | CID 174118093 |
|---|---|
| PubChem CID | 174118093 |
| Molecular Formula | C21H22BF2N9O8P2S |
| Molecular Weight | 671.28 g/mol |
| Exact Mass | 671.08 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2OP(O)(=S)OCC2O[C@@H](n3cnc4c(N)ccnc43)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C21H22BF2N9O8P2S/c22-42(34)36-3-9-16(12(24)21(38-9)33-7-31-14-17(26)28-5-29-19(14)33)41-43(35,44)37-4-10-15(40-42)11(23)20(39-10)32-6-30-13-8(25)1-2-27-18(13)32/h1-2,5-7,9-12,15-16,20-21H,3-4H2,(H2,25,27)(H,35,44)(H2,26,28,29)/t9-,10?,11-,12-,15-,16-,20-,21-,42?,43?/m1/s1 |
| InChIKey | QKSKSFSGCPHSKD-IRKAVJRYSA-N |
| XLogP | 1.22 |
| TPSA | 219.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|