C24H25B2F2N9O8P2 — CID 163516447
CID 163516447 (PubChem CID 163516447) has the molecular formula C24H25B2F2N9O8P2 and a molecular weight of 689.09 g/mol.
| Compound Name | CID 163516447 |
|---|---|
| PubChem CID | 163516447 |
| Molecular Formula | C24H25B2F2N9O8P2 |
| Molecular Weight | 689.09 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2OP([B])(=O)OC[C@H]2O[C@@H](n3nc4c5c(ccnc53)NCCC4)[C@@H](F)C2O1 |
| InChI | InChI=1S/C24H25B2F2N9O8P2/c25-46(38)41-7-13-19(16(28)24(43-13)37-21-14-10(3-5-31-21)30-4-1-2-11(14)35-37)45-47(26,39)40-6-12-18(44-46)15(27)23(42-12)36-9-34-17-20(29)32-8-33-22(17)36/h3,5,8-9,12-13,15-16,18-19,23-24,30H,1-2,4,6-7H2,(H2,29,32,33)/t12-,13-,15?,16+,18+,19?,23-,24-,46?,47?/m1/s1 |
| InChIKey | HBHATYKMDJALMH-AKDHSHCGSA-N |
| XLogP | 2.05 |
| TPSA | 201.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.09 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|