C26H28BFN8O10P2S — CID 163606290
CID 163606290 (PubChem CID 163606290) has the molecular formula C26H28BFN8O10P2S and a molecular weight of 736.38 g/mol.
| Compound Name | CID 163606290 |
|---|---|
| PubChem CID | 163606290 |
| Molecular Formula | C26H28BFN8O10P2S |
| Molecular Weight | 736.38 g/mol |
| Exact Mass | 736.12 |
| IUPAC Name | — |
| SMILES | [B]P1(=O)OC[C@H]2O[C@@H](n3cc4c5c(ccnc53)NC(=O)CC4)[C@@H](OC)C2OP(O)(=S)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)[C@H]2O1 |
| InChI | InChI=1S/C26H28BFN8O10P2S/c1-40-21-20-14(44-26(21)35-6-11-2-3-15(37)34-12-4-5-30-23(35)16(11)12)7-41-47(27,38)45-19-13(8-42-48(39,49)46-20)43-25(17(19)28)36-10-33-18-22(29)31-9-32-24(18)36/h4-6,9-10,13-14,17,19-21,25-26H,2-3,7-8H2,1H3,(H,34,37)(H,39,49)(H2,29,31,32)/t13-,14-,17?,19+,20?,21+,25-,26-,47?,48?/m1/s1 |
| InChIKey | SXQOAKPHRDXGBX-HUUMEIIRSA-N |
| XLogP | 1.80 |
| TPSA | 218.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|