C20H18N5O8P — CID 10896229
4-[[(2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl]chromen-2-one (PubChem CID 10896229) has the molecular formula C20H18N5O8P and a molecular weight of 487.37 g/mol. Its IUPAC name is 4-[[(2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl]chromen-2-one.
| Compound Name | 4-[[(2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl]chromen-2-one |
|---|---|
| PubChem CID | 10896229 |
| Molecular Formula | C20H18N5O8P |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-[[(2R,4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-7-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxymethyl]chromen-2-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CO[P@@](=O)(OCc3cc(=O)oc4ccccc34)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C20H18N5O8P/c21-18-15-19(23-8-22-18)25(9-24-15)20-16(27)17-13(32-20)7-30-34(28,33-17)29-6-10-5-14(26)31-12-4-2-1-3-11(10)12/h1-5,8-9,13,16-17,20,27H,6-7H2,(H2,21,22,23)/t13-,16-,17-,20-,34-/m1/s1 |
| InChIKey | DFZILPQHSXNRKO-IBDGRFQTSA-N |
| XLogP | 1.51 |
| TPSA | 174.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|