C16H14ClN5NaO6PS- — CID 169408565
CID 169408565 (PubChem CID 169408565) has the molecular formula C16H14ClN5NaO6PS- and a molecular weight of 493.80 g/mol.
| Compound Name | CID 169408565 |
|---|---|
| PubChem CID | 169408565 |
| Molecular Formula | C16H14ClN5NaO6PS- |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2c1nc(Sc1ccc(Cl)cc1)n2[C@@H]1O[C@@H]2COP(=O)([O-])O[C@H]2[C@H]1O.[Na] |
| InChI | InChI=1S/C16H15ClN5O6PS.Na/c17-7-1-3-8(4-2-7)30-16-21-10-13(18)19-6-20-14(10)22(16)15-11(23)12-9(27-15)5-26-29(24,25)28-12;/h1-4,6,9,11-12,15,23H,5H2,(H,24,25)(H2,18,19,20);/p-1/t9-,11-,12-,15-;/m1./s1 |
| InChIKey | PHGQLNFIDGOCGJ-DNBRLMRSSA-M |
| XLogP | 0.97 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|