C10H11N5NaO6PS — CID 90678058
sodium 9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-amino-7H-purine-8-thione (PubChem CID 90678058) has the molecular formula C10H11N5NaO6PS and a molecular weight of 383.26 g/mol. Its IUPAC name is sodium 9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-amino-7H-purine-8-thione.
| Compound Name | sodium 9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-amino-7H-purine-8-thione |
|---|---|
| PubChem CID | 90678058 |
| Molecular Formula | C10H11N5NaO6PS |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | sodium 9-[(4aR,6R,7R,7aS)-7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-amino-7H-purine-8-thione |
| SMILES | Nc1ncnc2c1[nH]c(=S)n2[C@@H]1O[C@@H]2COP(=O)([O-])O[C@H]2[C@H]1O.[Na+] |
| InChI | InChI=1S/C10H12N5O6PS.Na/c11-7-4-8(13-2-12-7)15(10(23)14-4)9-5(16)6-3(20-9)1-19-22(17,18)21-6;/h2-3,5-6,9,16H,1H2,(H,14,23)(H,17,18)(H2,11,12,13);/q;+1/p-1/t3-,5-,6-,9-;/m1./s1 |
| InChIKey | LUCNESJXIZBGIK-GWTDSMLYSA-M |
| XLogP | -3.78 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|