C10H12BN5O5PS+ — CID 90086054
CID 90086054 (PubChem CID 90086054) has the molecular formula C10H12BN5O5PS+ and a molecular weight of 356.09 g/mol.
| Compound Name | CID 90086054 |
|---|---|
| PubChem CID | 90086054 |
| Molecular Formula | C10H12BN5O5PS+ |
| Molecular Weight | 356.09 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3c(=S)[nH]c4c(N)ncnc43)C(O)[C@@H]2O1 |
| InChI | InChI=1S/C10H12BN5O5PS/c11-22(18)19-1-3-6(21-22)5(17)9(20-3)16-8-4(15-10(16)23)7(12)13-2-14-8/h2-3,5-6,9,17-18H,1H2,(H,15,23)(H2,12,13,14)/q+1/t3-,5?,6-,9-,22?/m1/s1 |
| InChIKey | PTRUHBOJZDLMEU-CFEKWVDZSA-N |
| XLogP | -0.42 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.09 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|