C10H11N5O3 — CID 135258372
(4R)-3-(6-aminopurin-9-yl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol (PubChem CID 135258372) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is (4R)-3-(6-aminopurin-9-yl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol.
| Compound Name | (4R)-3-(6-aminopurin-9-yl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol |
|---|---|
| PubChem CID | 135258372 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (4R)-3-(6-aminopurin-9-yl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COC2[C@H]1O |
| InChI | InChI=1S/C10H11N5O3/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(18-10)1-17-7/h2-4,6-7,10,16H,1H2,(H2,11,12,13)/t4?,6-,7?,10?/m1/s1 |
| InChIKey | SDEAOJDQCWVDBI-LLIYOGGQSA-N |
| XLogP | -0.93 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |