C11H14N5O6P — CID 142072687
(6R,7aR)-6-(6-aminopurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol;phosphenous acid (PubChem CID 142072687) has the molecular formula C11H14N5O6P and a molecular weight of 343.24 g/mol. Its IUPAC name is (6R,7aR)-6-(6-aminopurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol;phosphenous acid.
| Compound Name | (6R,7aR)-6-(6-aminopurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol;phosphenous acid |
|---|---|
| PubChem CID | 142072687 |
| Molecular Formula | C11H14N5O6P |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (6R,7aR)-6-(6-aminopurin-9-yl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol;phosphenous acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC2COCO[C@@H]2C1O.O=PO |
| InChI | InChI=1S/C11H13N5O4.HO2P/c12-9-6-10(14-2-13-9)16(3-15-6)11-7(17)8-5(20-11)1-18-4-19-8;1-3-2/h2-3,5,7-8,11,17H,1,4H2,(H2,12,13,14);(H,1,2)/t5?,7?,8-,11+;/m0./s1 |
| InChIKey | HNBYGSNQVVDXCI-GLRRSKSISA-N |
| XLogP | -0.77 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|