C21H24FN10O8P — CID 139502982
(1S,5R,6R,7R,9R,14S,15R,17S)-7,15-bis(6-aminopurin-9-yl)-6-fluoro-3-hydroxy-3-oxo-2,4,8,11,13-pentaoxa-3λ5-phosphatricyclo[12.2.1.05,9]heptadecan-17-ol (PubChem CID 139502982) has the molecular formula C21H24FN10O8P and a molecular weight of 594.46 g/mol. Its IUPAC name is (1S,5R,6R,7R,9R,14S,15R,17S)-7,15-bis(6-aminopurin-9-yl)-6-fluoro-3-hydroxy-3-oxo-2,4,8,11,13-pentaoxa-3λ5-phosphatricyclo[12.2.1.05,9]heptadecan-17-ol.
| Compound Name | (1S,5R,6R,7R,9R,14S,15R,17S)-7,15-bis(6-aminopurin-9-yl)-6-fluoro-3-hydroxy-3-oxo-2,4,8,11,13-pentaoxa-3λ5-phosphatricyclo[12.2.1.05,9]heptadecan-17-ol |
|---|---|
| PubChem CID | 139502982 |
| Molecular Formula | C21H24FN10O8P |
| Molecular Weight | 594.46 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | (1S,5R,6R,7R,9R,14S,15R,17S)-7,15-bis(6-aminopurin-9-yl)-6-fluoro-3-hydroxy-3-oxo-2,4,8,11,13-pentaoxa-3λ5-phosphatricyclo[12.2.1.05,9]heptadecan-17-ol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@@H]2OP(=O)(O)O[C@H]3[C@@H](F)[C@H](n4cnc5c(N)ncnc54)O[C@@H]3COCO[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C21H24FN10O8P/c22-11-16-10(38-21(11)32-6-30-13-18(24)26-4-28-20(13)32)2-36-7-37-15-8(1-9(14(15)33)39-41(34,35)40-16)31-5-29-12-17(23)25-3-27-19(12)31/h3-6,8-11,14-16,21,33H,1-2,7H2,(H,34,35)(H2,23,25,27)(H2,24,26,28)/t8-,9+,10-,11-,14-,15+,16-,21-/m1/s1 |
| InChIKey | YAWLLQSQCRGOAP-PQONOLLKSA-N |
| XLogP | -0.38 |
| TPSA | 242.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.46 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|