C10H13N5O2S — CID 14889121
6-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-7H-purine-8-thione (PubChem CID 14889121) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-7H-purine-8-thione.
| Compound Name | 6-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-7H-purine-8-thione |
|---|---|
| PubChem CID | 14889121 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 6-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-7H-purine-8-thione |
| SMILES | Nc1ncnc2c1[nH]c(=S)n2[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C10H13N5O2S/c11-8-7-9(13-4-12-8)15(10(18)14-7)6-2-1-5(3-16)17-6/h4-6,16H,1-3H2,(H,14,18)(H2,11,12,13)/t5-,6+/m0/s1 |
| InChIKey | VQKPOYGYLMKZBQ-NTSWFWBYSA-N |
| XLogP | 0.74 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|