C12H15N5O5S — CID 56994260
[(2R,3R,4R,5R)-2-(6-amino-8-sulfanylidene-7H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 56994260) has the molecular formula C12H15N5O5S and a molecular weight of 341.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-amino-8-sulfanylidene-7H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-amino-8-sulfanylidene-7H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 56994260 |
| Molecular Formula | C12H15N5O5S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-amino-8-sulfanylidene-7H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1c(=S)[nH]c2c(N)ncnc21 |
| InChI | InChI=1S/C12H15N5O5S/c1-4(19)21-8-7(20)5(2-18)22-11(8)17-10-6(16-12(17)23)9(13)14-3-15-10/h3,5,7-8,11,18,20H,2H2,1H3,(H,16,23)(H2,13,14,15)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | XVBSPBVHQWVMJR-IOSLPCCCSA-N |
| XLogP | -0.75 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|