C23H27N5O8S — CID 22840021
[(3aR,4R,6R,6aR)-4-(6-amino-8-sulfanylidene-7H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,4,5-trimethoxybenzoate (PubChem CID 22840021) has the molecular formula C23H27N5O8S and a molecular weight of 533.56 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(6-amino-8-sulfanylidene-7H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,4,5-trimethoxybenzoate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(6-amino-8-sulfanylidene-7H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 22840021 |
| Molecular Formula | C23H27N5O8S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(6-amino-8-sulfanylidene-7H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC[C@H]2O[C@@H](n3c(=S)[nH]c4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N5O8S/c1-23(2)35-16-13(8-33-21(29)10-6-11(30-3)15(32-5)12(7-10)31-4)34-20(17(16)36-23)28-19-14(27-22(28)37)18(24)25-9-26-19/h6-7,9,13,16-17,20H,8H2,1-5H3,(H,27,37)(H2,24,25,26)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | DXZSAOFFYGVZON-AEVYOOLXSA-N |
| XLogP | 2.37 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|