C21H33N5O6Si — CID 122389250
methyl 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-8-carboxylate (PubChem CID 122389250) has the molecular formula C21H33N5O6Si and a molecular weight of 479.61 g/mol. Its IUPAC name is methyl 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-8-carboxylate.
| Compound Name | methyl 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-8-carboxylate |
|---|---|
| PubChem CID | 122389250 |
| Molecular Formula | C21H33N5O6Si |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | methyl 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-aminopurine-8-carboxylate |
| SMILES | COC(=O)c1nc2c(N)ncnc2n1[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H33N5O6Si/c1-20(2,3)33(7,8)29-9-11-13-14(32-21(4,5)31-13)18(30-11)26-16-12(15(22)23-10-24-16)25-17(26)19(27)28-6/h10-11,13-14,18H,9H2,1-8H3,(H2,22,23,24)/t11-,13-,14-,18-/m1/s1 |
| InChIKey | WOGPOEZBANGOTO-XWXWGSFUSA-N |
| XLogP | 2.63 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|