C28H54FN5O4Si3 — CID 23656642
9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-fluoropurin-6-amine (PubChem CID 23656642) has the molecular formula C28H54FN5O4Si3 and a molecular weight of 628.03 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-fluoropurin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-fluoropurin-6-amine |
|---|---|
| PubChem CID | 23656642 |
| Molecular Formula | C28H54FN5O4Si3 |
| Molecular Weight | 628.03 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-8-fluoropurin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2c(F)nc3c(N)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54FN5O4Si3/c1-26(2,3)39(10,11)35-16-18-20(37-40(12,13)27(4,5)6)21(38-41(14,15)28(7,8)9)24(36-18)34-23-19(33-25(34)29)22(30)31-17-32-23/h17-18,20-21,24H,16H2,1-15H3,(H2,30,31,32)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | SGIMPWFAWWMIEL-UMCMBGNQSA-N |
| XLogP | 7.25 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.03 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|