C29H45N5O5SSi2 — CID 11072271
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl]oxy-phenoxymethanethione (PubChem CID 11072271) has the molecular formula C29H45N5O5SSi2 and a molecular weight of 631.95 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl]oxy-phenoxymethanethione.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl]oxy-phenoxymethanethione |
|---|---|
| PubChem CID | 11072271 |
| Molecular Formula | C29H45N5O5SSi2 |
| Molecular Weight | 631.95 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-3-yl]oxy-phenoxymethanethione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(=S)Oc1ccccc1 |
| InChI | InChI=1S/C29H45N5O5SSi2/c1-28(2,3)41(7,8)35-16-20-22(38-27(40)36-19-14-12-11-13-15-19)23(39-42(9,10)29(4,5)6)26(37-20)34-18-33-21-24(30)31-17-32-25(21)34/h11-15,17-18,20,22-23,26H,16H2,1-10H3,(H2,30,31,32)/t20-,22-,23-,26-/m1/s1 |
| InChIKey | FEXIDFYYQDKJCE-HUBRGWSESA-N |
| XLogP | 6.47 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.95 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|