C37H63N5O6Si3 — CID 10259549
N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]-N-methyl-2-phenoxyacetamide (PubChem CID 10259549) has the molecular formula C37H63N5O6Si3 and a molecular weight of 758.20 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]-N-methyl-2-phenoxyacetamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]-N-methyl-2-phenoxyacetamide |
|---|---|
| PubChem CID | 10259549 |
| Molecular Formula | C37H63N5O6Si3 |
| Molecular Weight | 758.20 g/mol |
| Exact Mass | 757.41 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]-N-methyl-2-phenoxyacetamide |
| SMILES | CN(C(=O)COc1ccccc1)c1ncnc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H63N5O6Si3/c1-35(2,3)49(11,12)45-22-27-30(47-50(13,14)36(4,5)6)31(48-51(15,16)37(7,8)9)34(46-27)42-25-40-29-32(38-24-39-33(29)42)41(10)28(43)23-44-26-20-18-17-19-21-26/h17-21,24-25,27,30-31,34H,22-23H2,1-16H3/t27-,30-,31-,34-/m1/s1 |
| InChIKey | MLKZGSPTUVAGJN-CIBJAQMISA-N |
| XLogP | 8.57 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.20 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|