C36H59N7O4Si3 — CID 46210058
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(5-phenyltriazol-1-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 46210058) has the molecular formula C36H59N7O4Si3 and a molecular weight of 738.17 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(5-phenyltriazol-1-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(5-phenyltriazol-1-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46210058 |
| Molecular Formula | C36H59N7O4Si3 |
| Molecular Weight | 738.17 g/mol |
| Exact Mass | 737.39 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(5-phenyltriazol-1-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(-n4nncc4-c4ccccc4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H59N7O4Si3/c1-34(2,3)48(10,11)44-22-27-29(46-49(12,13)35(4,5)6)30(47-50(14,15)36(7,8)9)33(45-27)42-24-39-28-31(42)37-23-38-32(28)43-26(21-40-41-43)25-19-17-16-18-20-25/h16-21,23-24,27,29-30,33H,22H2,1-15H3/t27-,29-,30-,33-/m1/s1 |
| InChIKey | PRSWEGNKRCWPHF-JHZZHVAFSA-N |
| XLogP | 8.77 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.17 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|