C35H58N7O4Si3 — CID 46210188
CID 46210188 (PubChem CID 46210188) has the molecular formula C35H58N7O4Si3 and a molecular weight of 725.15 g/mol.
| Compound Name | CID 46210188 |
|---|---|
| PubChem CID | 46210188 |
| Molecular Formula | C35H58N7O4Si3 |
| Molecular Weight | 725.15 g/mol |
| Exact Mass | 724.39 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(-n4nncc4[C]4[CH][CH][CH][CH]4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H58N7O4Si3/c1-33(2,3)47(10,11)43-21-26-28(45-48(12,13)34(4,5)6)29(46-49(14,15)35(7,8)9)32(44-26)41-23-38-27-30(41)36-22-37-31(27)42-25(20-39-40-42)24-18-16-17-19-24/h16-20,22-23,26,28-29,32H,21H2,1-15H3/t26-,28-,29-,32-/m1/s1 |
| InChIKey | AOLNJXWSUDCVNM-DWCTZGTLSA-N |
| XLogP | 7.86 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.15 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|