C31H60N4O5Si3 — CID 25136630
1-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]propan-1-ol (PubChem CID 25136630) has the molecular formula C31H60N4O5Si3 and a molecular weight of 653.10 g/mol. Its IUPAC name is 1-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]propan-1-ol.
| Compound Name | 1-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]propan-1-ol |
|---|---|
| PubChem CID | 25136630 |
| Molecular Formula | C31H60N4O5Si3 |
| Molecular Weight | 653.10 g/mol |
| Exact Mass | 652.39 |
| IUPAC Name | 1-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]propan-1-ol |
| SMILES | CCC(O)c1ncnc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H60N4O5Si3/c1-17-21(36)23-24-27(33-19-32-23)35(20-34-24)28-26(40-43(15,16)31(8,9)10)25(39-42(13,14)30(5,6)7)22(38-28)18-37-41(11,12)29(2,3)4/h19-22,25-26,28,36H,17-18H2,1-16H3/t21?,22-,25-,26-,28-/m1/s1 |
| InChIKey | BIJYVPDRHDVYBF-PFNIOKPUSA-N |
| XLogP | 7.97 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.10 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|