C38H62N4O8Si3 — CID 71817572
[3-acetyloxy-2-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate (PubChem CID 71817572) has the molecular formula C38H62N4O8Si3 and a molecular weight of 787.19 g/mol. Its IUPAC name is [3-acetyloxy-2-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate.
| Compound Name | [3-acetyloxy-2-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 71817572 |
| Molecular Formula | C38H62N4O8Si3 |
| Molecular Weight | 787.19 g/mol |
| Exact Mass | 786.39 |
| IUPAC Name | [3-acetyloxy-2-[9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(OC(C)=O)c1-c1ncnc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H62N4O8Si3/c1-24(43)46-26-19-18-20-27(47-25(2)44)29(26)30-31-34(40-22-39-30)42(23-41-31)35-33(50-53(16,17)38(9,10)11)32(49-52(14,15)37(6,7)8)28(48-35)21-45-51(12,13)36(3,4)5/h18-20,22-23,28,32-33,35H,21H2,1-17H3/t28-,32-,33-,35-/m1/s1 |
| InChIKey | RTSDNPDCDZBMSR-CEEZKUQMSA-N |
| XLogP | 9.04 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.19 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|