C36H60N4O6Si3 — CID 154717862
[2-[9-[(3S,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate (PubChem CID 154717862) has the molecular formula C36H60N4O6Si3 and a molecular weight of 729.16 g/mol. Its IUPAC name is [2-[9-[(3S,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate.
| Compound Name | [2-[9-[(3S,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 154717862 |
| Molecular Formula | C36H60N4O6Si3 |
| Molecular Weight | 729.16 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | [2-[9-[(3S,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1-c1ncnc2c1ncn2C1O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H60N4O6Si3/c1-24(41)43-26-20-18-17-19-25(26)28-29-32(38-22-37-28)40(23-39-29)33-31(46-49(15,16)36(8,9)10)30(45-48(13,14)35(5,6)7)27(44-33)21-42-47(11,12)34(2,3)4/h17-20,22-23,27,30-31,33H,21H2,1-16H3/t27-,30-,31-,33?/m0/s1 |
| InChIKey | DSANAKNCWIKKTI-WFZMQKEQSA-N |
| XLogP | 9.12 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.16 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|