C28H53N7O4Si3 — CID 75149881
[5-(6-azidopurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 75149881) has the molecular formula C28H53N7O4Si3 and a molecular weight of 636.04 g/mol. Its IUPAC name is [5-(6-azidopurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [5-(6-azidopurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 75149881 |
| Molecular Formula | C28H53N7O4Si3 |
| Molecular Weight | 636.04 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | [5-(6-azidopurin-9-yl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2cnc3c(N=[N+]=[N-])ncnc32)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H53N7O4Si3/c1-26(2,3)40(10,11)36-16-19-21(38-41(12,13)27(4,5)6)22(39-42(14,15)28(7,8)9)25(37-19)35-18-32-20-23(33-34-29)30-17-31-24(20)35/h17-19,21-22,25H,16H2,1-15H3 |
| InChIKey | HBGDJMZAYMWEIY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 129.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.04 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|