C30H56N4O5Si3 — CID 25136518
[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(oxiran-2-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 25136518) has the molecular formula C30H56N4O5Si3 and a molecular weight of 637.06 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(oxiran-2-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(oxiran-2-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 25136518 |
| Molecular Formula | C30H56N4O5Si3 |
| Molecular Weight | 637.06 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[6-(oxiran-2-yl)purin-9-yl]oxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(C4CO4)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56N4O5Si3/c1-28(2,3)40(10,11)36-17-21-24(38-41(12,13)29(4,5)6)25(39-42(14,15)30(7,8)9)27(37-21)34-19-33-23-22(20-16-35-20)31-18-32-26(23)34/h18-21,24-25,27H,16-17H2,1-15H3/t20?,21-,24-,25-,27-/m1/s1 |
| InChIKey | NQDWKTQDUZTMOI-KVTQNQFWSA-N |
| XLogP | 7.60 |
| TPSA | 93.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.06 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|