C22H39ClN4O4Si2 — CID 174009285
[(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-chloropurin-9-yl)oxolan-2-yl]methanol (PubChem CID 174009285) has the molecular formula C22H39ClN4O4Si2 and a molecular weight of 515.20 g/mol. Its IUPAC name is [(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-chloropurin-9-yl)oxolan-2-yl]methanol.
| Compound Name | [(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-chloropurin-9-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 174009285 |
| Molecular Formula | C22H39ClN4O4Si2 |
| Molecular Weight | 515.20 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | [(2R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(6-chloropurin-9-yl)oxolan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C(O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1n1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C22H39ClN4O4Si2/c1-21(2,3)32(7,8)30-16-14(11-28)29-20(17(16)31-33(9,10)22(4,5)6)27-13-26-15-18(23)24-12-25-19(15)27/h12-14,16-17,20,28H,11H2,1-10H3/t14-,16?,17?,20-/m1/s1 |
| InChIKey | MFJUTUPAZMCBJI-SPTDJYCLSA-N |
| XLogP | 5.15 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.20 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|