C30H46N4O5Si2 — CID 71817733
[2-[9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate (PubChem CID 71817733) has the molecular formula C30H46N4O5Si2 and a molecular weight of 598.89 g/mol. Its IUPAC name is [2-[9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate.
| Compound Name | [2-[9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 71817733 |
| Molecular Formula | C30H46N4O5Si2 |
| Molecular Weight | 598.89 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | [2-[9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1-c1ncnc2c1ncn2[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C30H46N4O5Si2/c1-20(35)37-22-15-13-12-14-21(22)26-27-28(32-18-31-26)34(19-33-27)25-16-23(39-41(10,11)30(5,6)7)24(38-25)17-36-40(8,9)29(2,3)4/h12-15,18-19,23-25H,16-17H2,1-11H3/t23-,24+,25+/m0/s1 |
| InChIKey | LXLLCKPMRWOVCN-ISJGIBHGSA-N |
| XLogP | 7.12 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.89 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|