C31H46N4O3Si2 — CID 101463064
tert-butyl-[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[6-[2-(2-methylphenyl)ethynyl]purin-9-yl]oxolan-3-yl]oxy-dimethylsilane (PubChem CID 101463064) has the molecular formula C31H46N4O3Si2 and a molecular weight of 578.91 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[6-[2-(2-methylphenyl)ethynyl]purin-9-yl]oxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[6-[2-(2-methylphenyl)ethynyl]purin-9-yl]oxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101463064 |
| Molecular Formula | C31H46N4O3Si2 |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | tert-butyl-[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[6-[2-(2-methylphenyl)ethynyl]purin-9-yl]oxolan-3-yl]oxy-dimethylsilane |
| SMILES | Cc1ccccc1C#Cc1ncnc2c1ncn2[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H46N4O3Si2/c1-22-14-12-13-15-23(22)16-17-24-28-29(33-20-32-24)35(21-34-28)27-18-25(38-40(10,11)31(5,6)7)26(37-27)19-36-39(8,9)30(2,3)4/h12-15,20-21,25-27H,18-19H2,1-11H3/t25-,26+,27+/m0/s1 |
| InChIKey | KXZLQZXLFCIYMM-OYUWMTPXSA-N |
| XLogP | 7.23 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|