C22H40N4O5Si2 — CID 102507017
9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-hydroxypurin-6-one (PubChem CID 102507017) has the molecular formula C22H40N4O5Si2 and a molecular weight of 496.76 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-hydroxypurin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-hydroxypurin-6-one |
|---|---|
| PubChem CID | 102507017 |
| Molecular Formula | C22H40N4O5Si2 |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-1-hydroxypurin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(=O)n(O)cnc32)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40N4O5Si2/c1-21(2,3)32(7,8)29-12-16-15(31-33(9,10)22(4,5)6)11-17(30-16)25-13-23-18-19(25)24-14-26(28)20(18)27/h13-17,28H,11-12H2,1-10H3/t15-,16+,17+/m0/s1 |
| InChIKey | FHURUHCOZUXIBZ-GVDBMIGSSA-N |
| XLogP | 4.53 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|