C30H48IN5O3Si2 — CID 59736556
9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[1-(4-iodophenyl)ethyl]purin-6-amine (PubChem CID 59736556) has the molecular formula C30H48IN5O3Si2 and a molecular weight of 709.82 g/mol. Its IUPAC name is 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[1-(4-iodophenyl)ethyl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[1-(4-iodophenyl)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 59736556 |
| Molecular Formula | C30H48IN5O3Si2 |
| Molecular Weight | 709.82 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[1-(4-iodophenyl)ethyl]purin-6-amine |
| SMILES | CC(Nc1ncnc2c1ncn2[C@H]1CC(O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1)c1ccc(I)cc1 |
| InChI | InChI=1S/C30H48IN5O3Si2/c1-20(21-12-14-22(31)15-13-21)35-27-26-28(33-18-32-27)36(19-34-26)25-16-23(39-41(10,11)30(5,6)7)24(38-25)17-37-40(8,9)29(2,3)4/h12-15,18-20,23-25H,16-17H2,1-11H3,(H,32,33,35)/t20?,23?,24-,25-/m1/s1 |
| InChIKey | XRQGENZDIQBNRO-WANAXYPZSA-N |
| XLogP | 8.30 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.82 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|